Arenediazonium ion insertion into an iron–phosphine bond; synthesis and crystal structure of [Fe(NO)2{PPh2CH2CH2P(Ph)2NN(C6H4F-p)}][PF6]·OC4H8
Abstract
The reaction of [Fe(NO)2(dppe)](dppe = Ph2PCH2CH2PPh2) with [N2C6H4F-p][PF6] gave [Fe(NO)2{PPh2CH2CH2P(Ph)2NN(C6H4F-p)}][PF6] X-ray studies on which revealed the formation of a novel chelating ligand bound to iron through phosphine and η2-NN functionalities and resulting from insertion of an arenediazo group into an iron–phosphorus bond.