Macrocyclic liquid crystals from functionalised thioether crowns: the single-crystal X-ray structures of cis- and trans-R2[14]aneS4(R = O2CC6H4OMe-4)
Abstract
The syntheses of cis and trans oligobenzoate ester derivatives R2[14]aneS4 are described; the structure of the cis and trans derivatives for R = O2CC6H4OMe-4 are dominated by intermolecular packing between benzoate ester units, while the cis and trans derivatives for R = O2CC6H4(O2CC6H4OC8H17-4)-4 both show nematic mesophases.