Regioselective synthesis and electrochemical properties of π-conjugated cobaltacyclopentadiene oligomer and polymer complexes
Abstract
Perfectly π-conjugated cobaltacyclopentadiene oligomer and polymer complexes were synthesized by polycondensation of a dihalogenated cobaltacyclopentadiene complex, [Co{C(C6H4I-4)CBunCBunC(C6H4I-4)}(cp)(PPh3)] (cp = η5-C5H5), with [Ni(cod)2] (cod = cycloocta-1,5-diene). Their internuclear electronic interaction energy in the mixed-valence state, uOR, was estimated to be ca. –2 kJ mol–1 by electrochemical analysis.